Products 55486-06-1
CAS 55486-06-1 is the registry number for Nepetoidin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (CAS 55486-06-1) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: [(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate. InChIKey: GFZFUVWXGQWUGX-DGEKEWMVSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | [(Z)-2-(3,4-dihydroxyphenyl)ethenyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| InChIKey | GFZFUVWXGQWUGX-DGEKEWMVSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/C(=O)O/C=C\C2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)