CAS 55687-02-0 appears in our catalog under these names: 6-Bromo-2-chloroquinoxaline 98%, 6-Bromo-2-chloroquinoxaline, 98%, 98%, 6-Bromo-2-chloroquinoxaline, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 10g.
6-bromo-2-chloroquinoxaline (CAS 55687-02-0) is a chemical compound with the molecular formula C8H4BrClN2 and a molecular weight of 243.49 g/mol. IUPAC name: 6-bromo-2-chloroquinoxaline. InChIKey: XDJDRCGDVKTDHY-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClN2 |
|---|---|
| Molecular weight | 243.49 g/mol |
| IUPAC name | 6-bromo-2-chloroquinoxaline |
| InChIKey | XDJDRCGDVKTDHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN=C2C=C1Br)Cl |
Computed by PubChem (NCBI)