CAS 55736-71-5 is the registry number for 1-(3,4-Dichloro-2-hydroxyphenyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1-(3,4-dichloro-2-hydroxyphenyl)ethanone (CAS 55736-71-5) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 1-(3,4-dichloro-2-hydroxyphenyl)ethanone. InChIKey: IAPWSRGXLFGVQR-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 1-(3,4-dichloro-2-hydroxyphenyl)ethanone |
| InChIKey | IAPWSRGXLFGVQR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)