CAS 55798-31-7 appears in our catalog under these names: 5-Amino-2-ethylbenzo(d)isothiazol-3(2H)-one 1,1-dioxide, 98%, 5-Amino-2-ethylbenzo[d]isothiazol-3(2h)-one 1,1-dioxide, 98%, 98%, 5-Amino-2-ethylbenzo[d]isothiazol-3(2h)-one 1,1-dioxide, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-amino-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one (CAS 55798-31-7) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 5-amino-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one. InChIKey: OZHSTCZOTQFRKH-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 5-amino-2-ethyl-1,1-dioxo-1,2-benzothiazol-3-one |
| InChIKey | OZHSTCZOTQFRKH-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(S1(=O)=O)C=CC(=C2)N |
Computed by PubChem (NCBI)