CAS 55942-40-0 appears in our catalog under these names: diethyl 1h-pyrrole-2,4-dicarboxylate, Diethyl 1H-pyrrole-2,4-dicarboxylate 95%, Diethyl 1H-pyrrole-2,4-dicarboxylate, 95%, 95%, DIETHYL 1H-PYRROLE-2,4-DICARBOXYLATE, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 50g, 250mg, 1g, 100g.
Diethyl 1H-pyrrole-2,4-dicarboxylate (CAS 55942-40-0) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: diethyl 1H-pyrrole-2,4-dicarboxylate. InChIKey: SQDULIUHZHMBIC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | diethyl 1H-pyrrole-2,4-dicarboxylate |
| InChIKey | SQDULIUHZHMBIC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CN1)C(=O)OCC |
Computed by PubChem (NCBI)