CAS 56041-30-6 is the registry number for 5-(Pyridin-2-yl)-1H-1,2,4-triazol-3(2H)-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-pyridin-2-yl-1,4-dihydro-1,2,4-triazol-5-one (CAS 56041-30-6) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 3-pyridin-2-yl-1,4-dihydro-1,2,4-triazol-5-one. InChIKey: DVWNVWACWAWYOX-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-pyridin-2-yl-1,4-dihydro-1,2,4-triazol-5-one |
| InChIKey | DVWNVWACWAWYOX-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NNC(=O)N2 |
Computed by PubChem (NCBI)