CAS 56071-04-6 appears in our catalog under these names: 2-(3-Methoxyphenyl)Quinazolin-4(3H)-One, 98%, 98%, 2-(3-methoxyphenyl)-1,4-dihydroquinazolin-4-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(3-methoxyphenyl)-3H-quinazolin-4-one (CAS 56071-04-6) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 2-(3-methoxyphenyl)-3H-quinazolin-4-one. InChIKey: DUQSFLFKFAGWIS-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-3H-quinazolin-4-one |
| InChIKey | DUQSFLFKFAGWIS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)