Products 56079-91-5
CAS 56079-91-5 appears in our catalog under these names: Phenytoin Sodium impurity 8, Phenytoin Impurity 10. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(4-nitrophenyl)-5-phenylimidazolidine-2,4-dione (CAS 56079-91-5) is a chemical compound with the molecular formula C15H11N3O4 and a molecular weight of 297.26 g/mol. IUPAC name: 5-(4-nitrophenyl)-5-phenylimidazolidine-2,4-dione. InChIKey: FMQQDZHVEBMJKM-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 5-(4-nitrophenyl)-5-phenylimidazolidine-2,4-dione |
| InChIKey | FMQQDZHVEBMJKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)