Products 352341-25-4
CAS 352341-25-4 is the registry number for 5-(2-Methoxyphenyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 100g, 5g.
5-(2-methoxyphenyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole (CAS 352341-25-4) is a chemical compound with the molecular formula C15H11N3O4 and a molecular weight of 297.26 g/mol. IUPAC name: 5-(2-methoxyphenyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole. InChIKey: RVXOFACJJMKRHR-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 5-(2-methoxyphenyl)-3-(3-nitrophenyl)-1,2,4-oxadiazole |
| InChIKey | RVXOFACJJMKRHR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=NC(=NO2)C3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)