Products 945367-11-3
CAS 945367-11-3 is the registry number for 2-[(1,3-Benzodioxol-5-ylmethyl)amino]-5-nitrobenzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,3-benzodioxol-5-ylmethylamino)-5-nitrobenzonitrile (CAS 945367-11-3) is a chemical compound with the molecular formula C15H11N3O4 and a molecular weight of 297.26 g/mol. IUPAC name: 2-(1,3-benzodioxol-5-ylmethylamino)-5-nitrobenzonitrile. InChIKey: LTXFNSHURXROKB-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 2-(1,3-benzodioxol-5-ylmethylamino)-5-nitrobenzonitrile |
| InChIKey | LTXFNSHURXROKB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNC3=C(C=C(C=C3)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)