CAS 889941-16-6 is the registry number for 1-Methyl-2,4-dioxo-7-phenyl-1H,2H,3H,4H-pyrido(2,3-d)pyrimidine-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid (CAS 889941-16-6) is a chemical compound with the molecular formula C15H11N3O4 and a molecular weight of 297.26 g/mol. IUPAC name: 1-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid. InChIKey: DENKARDJQJWKFA-UHFFFAOYSA-N.
| Molecular formula | C15H11N3O4 |
|---|---|
| Molecular weight | 297.26 g/mol |
| IUPAC name | 1-methyl-2,4-dioxo-7-phenylpyrido[2,3-d]pyrimidine-5-carboxylic acid |
| InChIKey | DENKARDJQJWKFA-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC(=N2)C3=CC=CC=C3)C(=O)O)C(=O)NC1=O |
Computed by PubChem (NCBI)