CAS 56080-99-0 appears in our catalog under these names: (R)-1-Benzyl-pyrrolidine-2-carboxylic Acid (May Contain up to 15% inorganics), (R)–1–Benzylpyrrolidine–2–carboxylic acid, Bzl-D-Pro-OH 97%, (R)-1-Benzylpyrrolidine-2-carboxylic acid, 97%, 97%, (R)-1-Benzylpyrrolidine-2-carboxylic acid, 98.99%. Offered by: TRC, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 10g, 100g, 25g, 5g, 10 g, 25 g, 100 g.
(2R)-1-benzylpyrrolidine-2-carboxylic acid (CAS 56080-99-0) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: (2R)-1-benzylpyrrolidine-2-carboxylic acid. InChIKey: XNROFTAJEGCDCT-LLVKDONJSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | (2R)-1-benzylpyrrolidine-2-carboxylic acid |
| InChIKey | XNROFTAJEGCDCT-LLVKDONJSA-N |
| SMILES | C1C[C@@H](N(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)