CAS 561-95-5 is the registry number for Nimbiol. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4aS,10aS)-6-hydroxy-1,1,4a,7-tetramethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one (CAS 561-95-5) is a chemical compound with the molecular formula C18H24O2 and a molecular weight of 272.4 g/mol. IUPAC name: (4aS,10aS)-6-hydroxy-1,1,4a,7-tetramethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one. InChIKey: XVAVQANUJQBBFF-FUHWJXTLSA-N.
| Molecular formula | C18H24O2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (4aS,10aS)-6-hydroxy-1,1,4a,7-tetramethyl-3,4,10,10a-tetrahydro-2H-phenanthren-9-one |
| InChIKey | XVAVQANUJQBBFF-FUHWJXTLSA-N |
| SMILES | CC1=CC2=C(C=C1O)[C@]3(CCCC([C@@H]3CC2=O)(C)C)C |
Computed by PubChem (NCBI)