CAS 56100-19-7 appears in our catalog under these names: 4–Methyl–2,2'–bipyridine, 4-Methyl-2,2'-bipyridine 98%, 4-Methyl-2,2'-bipyridine, 98%, 98%, 4-Methyl-[2,2']bipyridinyl, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 100mg, 250mg, 5g, 10g, 25g.
4-methyl-2-pyridin-2-ylpyridine (CAS 56100-19-7) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 4-methyl-2-pyridin-2-ylpyridine. InChIKey: OHSRAWAUPZWNKY-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 4-methyl-2-pyridin-2-ylpyridine |
| InChIKey | OHSRAWAUPZWNKY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC=C1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)