CAS 56100-22-2 appears in our catalog under these names: 6-Methyl-2,2'-bipyridine, 98%, 6-Methyl-2,2'-bipyridine, 95-<97%, 6-Methyl-2,2'-bipyridine, ≥97-<99%, 6-Methyl-2,2′-dipyridyl 98%, 6-Methyl-2,2'-bipyridine, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 100mg.
2-methyl-6-pyridin-2-ylpyridine (CAS 56100-22-2) is a chemical compound with the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. IUPAC name: 2-methyl-6-pyridin-2-ylpyridine. InChIKey: LLCYXFYLGPOKQO-UHFFFAOYSA-N.
| Molecular formula | C11H10N2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 2-methyl-6-pyridin-2-ylpyridine |
| InChIKey | LLCYXFYLGPOKQO-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)