Products 561007-08-7
CAS 561007-08-7 is the registry number for 3-Amino-1,1,1-trifluoro-2-phenylpropan-2-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol (CAS 561007-08-7) is a chemical compound with the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. IUPAC name: 3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol. InChIKey: DKZXEFKUTNBVTE-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NO |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 3-amino-1,1,1-trifluoro-2-phenylpropan-2-ol |
| InChIKey | DKZXEFKUTNBVTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CN)(C(F)(F)F)O |
Computed by PubChem (NCBI)