CAS 5614-53-9 appears in our catalog under these names: Theophylline Impurity 1 discontinued see RM-D190635, Doxofylline Impurity 1, Theophylline-7-acetaldehyde, >95% (HPLC), Doxofylline Impurity 2, Doxofylline Impurity 9. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde (CAS 5614-53-9) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde. InChIKey: LXIWYKGAOIXZFO-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetaldehyde |
| InChIKey | LXIWYKGAOIXZFO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CC=O |
Computed by PubChem (NCBI)