CAS 878441-48-6 appears in our catalog under these names: 3-(5-Methyl-7-oxo-4,7-dihydro[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid, 95%, 3-(5-Methyl-7-oxo-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-propionic acid, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 500mg.
3-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 878441-48-6) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 3-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: MMSLJBLQCQNPAU-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 3-(5-methyl-7-oxo-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | MMSLJBLQCQNPAU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)N=CN2)CCC(=O)O |
Computed by PubChem (NCBI)