Products 1095822-63-1
CAS 1095822-63-1 is the registry number for 6,7,8,9-Tetrahydro-6-methyl-8-oxo-5h-pyrimido[4,5-e][1,4]diazepine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-methyl-8-oxo-7,9-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-4-carboxylic acid (CAS 1095822-63-1) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 6-methyl-8-oxo-7,9-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-4-carboxylic acid. InChIKey: UFNJHDOIZGLUBG-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 6-methyl-8-oxo-7,9-dihydro-5H-pyrimido[4,5-e][1,4]diazepine-4-carboxylic acid |
| InChIKey | UFNJHDOIZGLUBG-UHFFFAOYSA-N |
| SMILES | CN1CC2=C(N=CN=C2NC(=O)C1)C(=O)O |
Computed by PubChem (NCBI)