CAS 1011349-98-6 is the registry number for 3,5-Dimethyl-4-((4-nitro-1H-pyrazol-1-yl)methyl)isoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dimethyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole (CAS 1011349-98-6) is a chemical compound with the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. IUPAC name: 3,5-dimethyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole. InChIKey: RPSODSGIRVGXBF-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O3 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 3,5-dimethyl-4-[(4-nitropyrazol-1-yl)methyl]-1,2-oxazole |
| InChIKey | RPSODSGIRVGXBF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CN2C=C(C=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)