CAS 56227-55-5 appears in our catalog under these names: 1-Benzoylpiperazine hydrochloride, Methanone, phenyl-1-piperazinyl-, hydrochloride (1:1), 98%, 98%, 1-Benzoylpiperazine hydrochloride, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 10g, 100g.
Phenyl(piperazin-1-yl)methanone;hydrochloride (CAS 56227-55-5) is a chemical compound with the molecular formula C11H15ClN2O and a molecular weight of 226.70 g/mol. IUPAC name: phenyl(piperazin-1-yl)methanone;hydrochloride. InChIKey: KSVFXAZDBKITEF-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O |
|---|---|
| Molecular weight | 226.70 g/mol |
| IUPAC name | phenyl(piperazin-1-yl)methanone;hydrochloride |
| InChIKey | KSVFXAZDBKITEF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)