CAS 5623-24-5 appears in our catalog under these names: 2–hydroxy–1,2–bis(4–(propan–2–yl)phenyl)ethanone, Ethanone, 2-hydroxy-1,2-bis[4-(1-methylethyl)phenyl]-. Offered by: GLPBio, Chemat. Available pack sizes: 25g, 5g.
2-hydroxy-1,2-bis(4-propan-2-ylphenyl)ethanone (CAS 5623-24-5) is a chemical compound with the molecular formula C20H24O2 and a molecular weight of 296.4 g/mol. IUPAC name: 2-hydroxy-1,2-bis(4-propan-2-ylphenyl)ethanone. InChIKey: KYFSSDITIZHVRH-UHFFFAOYSA-N.
| Molecular formula | C20H24O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 2-hydroxy-1,2-bis(4-propan-2-ylphenyl)ethanone |
| InChIKey | KYFSSDITIZHVRH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)C(C)C)O |
Computed by PubChem (NCBI)