CAS 56251-58-2 appears in our catalog under these names: 6-Bromo-2H-1,3-benzodioxol-5-amine, 98%, 6-Bromobenzo[d][1,3]dioxol-5-amine 98%, 6-Bromo-2H-1,3-benzodioxol-5-amine, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g, 500mg, 2.5g.
6-bromo-1,3-benzodioxol-5-amine (CAS 56251-58-2) is a chemical compound with the molecular formula C7H6BrNO2 and a molecular weight of 216.03 g/mol. IUPAC name: 6-bromo-1,3-benzodioxol-5-amine. InChIKey: RIAWWMUJPLZBMT-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO2 |
|---|---|
| Molecular weight | 216.03 g/mol |
| IUPAC name | 6-bromo-1,3-benzodioxol-5-amine |
| InChIKey | RIAWWMUJPLZBMT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)N)Br |
Computed by PubChem (NCBI)