CAS 563539-31-1 is the registry number for 3-tert-Butyl-6-chloro-2,3,4,9-tetrahydro-1H-carbazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-tert-butyl-6-chloro-2,3,4,9-tetrahydro-1H-carbazole (CAS 563539-31-1) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: 3-tert-butyl-6-chloro-2,3,4,9-tetrahydro-1H-carbazole. InChIKey: RZLRQRPFXZFMPI-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | 3-tert-butyl-6-chloro-2,3,4,9-tetrahydro-1H-carbazole |
| InChIKey | RZLRQRPFXZFMPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)C3=C(N2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)