Products 56391-55-0
CAS 56391-55-0 appears in our catalog under these names: Octazamide, Octazamide ( ICI–US 457), Octazamide, 98.55%, 98.55%, Octazamide, 99.07%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 10mg, 20mg, 5mg, 1 mg.
[(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-phenylmethanone (CAS 56391-55-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: [(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-phenylmethanone. InChIKey: ZSYULWHBPBAOKV-TXEJJXNPSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | [(3aS,6aR)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]-phenylmethanone |
| InChIKey | ZSYULWHBPBAOKV-TXEJJXNPSA-N |
| SMILES | C1[C@@H]2COC[C@@H]2CN1C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)