CAS 564-88-5 is the registry number for 11, 13-cis-Retinal (>65%). Offered by: TRC. Available pack sizes: 25mg.
(2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal (CAS 564-88-5) is a chemical compound with the molecular formula C20H28O and a molecular weight of 284.4 g/mol. IUPAC name: (2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal. InChIKey: NCYCYZXNIZJOKI-PXXZYBOJSA-N.
| Molecular formula | C20H28O |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (2Z,4Z,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenal |
| InChIKey | NCYCYZXNIZJOKI-PXXZYBOJSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C\C(=C/C=O)\C)/C |
Computed by PubChem (NCBI)