CAS 56413-75-3 appears in our catalog under these names: 2–Nitrophenylhydrazine Hydrochloride, (2-Nitrophenyl)hydrazine xhydrochloride, 97%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 10g, 500g.
(2-nitrophenyl)hydrazine;hydrochloride (CAS 56413-75-3) is a chemical compound with the molecular formula C6H8ClN3O2 and a molecular weight of 189.60 g/mol. IUPAC name: (2-nitrophenyl)hydrazine;hydrochloride. InChIKey: XCUBVSAYUSFHNN-UHFFFAOYSA-N.
| Molecular formula | C6H8ClN3O2 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | (2-nitrophenyl)hydrazine;hydrochloride |
| InChIKey | XCUBVSAYUSFHNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)