CAS 56430-08-1 appears in our catalog under these names: 4’-Methylphenazone, >95% (HPLC), 4'-Methylphenazone 95%, 1,5-Dimethyl-2-(p-tolyl)-1H-pyrazol-3(2H)-one, 97%, 97%, 1,5-Dimethyl-2-(p-tolyl)-1H-pyrazol-3(2H)-one, 97%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
1,5-dimethyl-2-(4-methylphenyl)pyrazol-3-one (CAS 56430-08-1) is a chemical compound with the molecular formula C12H14N2O and a molecular weight of 202.25 g/mol. IUPAC name: 1,5-dimethyl-2-(4-methylphenyl)pyrazol-3-one. InChIKey: CSVSLJZHBKTVNT-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | 1,5-dimethyl-2-(4-methylphenyl)pyrazol-3-one |
| InChIKey | CSVSLJZHBKTVNT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)C=C(N2C)C |
Computed by PubChem (NCBI)