Products 56456-51-0
CAS 56456-51-0 appears in our catalog under these names: 2–Chloro–4–(trifluoromethyl)benzylalcohol, 2-Chloro-4-(trifluoromethyl)benzyl alcohol, 97%, 97%, 2-Chloro-4-(trifluoromethyl)benzyl alcohol, 95%, 2-Chloro-4-(trifluoromethyl)benzyl alcohol, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
[2-chloro-4-(trifluoromethyl)phenyl]methanol (CAS 56456-51-0) is a chemical compound with the molecular formula C8H6ClF3O and a molecular weight of 210.58 g/mol. IUPAC name: [2-chloro-4-(trifluoromethyl)phenyl]methanol. InChIKey: GMZPPTCATYZORA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3O |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | [2-chloro-4-(trifluoromethyl)phenyl]methanol |
| InChIKey | GMZPPTCATYZORA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Cl)CO |
Computed by PubChem (NCBI)