CAS 56468-67-8 appears in our catalog under these names: (3-Benzyloxy-phenyl)hydrazine hydrochloride, (3-Benzyloxy-phenyl)hydrazine hydrochlor, ide, 5 g, (3-Benzyloxy-phenyl)hydrazine hydrochlor, ide, 10 g, (3-Benzyloxy-phenyl)hydrazine hydrochlor, ide, 25 g, (3-Benzyloxy-phenyl)hydrazine hydrochlor, ide, 50 g. Offered by: Biosynth, Roth. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
(3-phenylmethoxyphenyl)hydrazine;hydrochloride (CAS 56468-67-8) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: (3-phenylmethoxyphenyl)hydrazine;hydrochloride. InChIKey: MMMGCMOISVZVKZ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | (3-phenylmethoxyphenyl)hydrazine;hydrochloride |
| InChIKey | MMMGCMOISVZVKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)NN.Cl |
Computed by PubChem (NCBI)