CAS 59146-68-8 is the registry number for 3-Benzyloxyphenylhydrazine hydrochloride, 98%. Offered by: Thermo Scientific (Acros). Available pack sizes: 1g, 5g.
(3-phenylmethoxyphenyl)hydrazine;hydrochloride (CAS 59146-68-8) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 250.72 g/mol. IUPAC name: (3-phenylmethoxyphenyl)hydrazine;hydrochloride. InChIKey: MMMGCMOISVZVKZ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 250.72 g/mol |
| IUPAC name | (3-phenylmethoxyphenyl)hydrazine;hydrochloride |
| InChIKey | MMMGCMOISVZVKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)NN.Cl |
Computed by PubChem (NCBI)