Products 56518-39-9
CAS 56518-39-9 is the registry number for 3-(4-Bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)-2-propenenitrile-d6. Offered by: Biosynth. Available pack sizes: 500mg, 250mg.
(E)-3-(4-bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)prop-2-enenitrile (CAS 56518-39-9) is a chemical compound with the molecular formula C13H14BrNO3 and a molecular weight of 312.16 g/mol. IUPAC name: (E)-3-(4-bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)prop-2-enenitrile. InChIKey: FZVLRBPIBXTWKY-ONNFQVAWSA-N.
| Molecular formula | C13H14BrNO3 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | (E)-3-(4-bromo-3,5-dimethoxyphenyl)-2-(methoxymethyl)prop-2-enenitrile |
| InChIKey | FZVLRBPIBXTWKY-ONNFQVAWSA-N |
| SMILES | COC/C(=C/C1=CC(=C(C(=C1)OC)Br)OC)/C#N |
Computed by PubChem (NCBI)