Products 56539-85-6
CAS 56539-85-6 appears in our catalog under these names: 3,3,3-Trifluoro-2-phenylpropionic acid, 95%, 3，3，3–Trifluoro–2–phenylpropionic Acid, 3,3,3-Trifluoro-2-phenylpropionic acid, 3，3，3-Trifluoro-2-phenylpropionic Acid, >97%, >97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 0,5g, 50mg, 100mg.
3,3,3-trifluoro-2-phenylpropanoic acid (CAS 56539-85-6) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 3,3,3-trifluoro-2-phenylpropanoic acid. InChIKey: HQRSIMQXCAWAJB-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 3,3,3-trifluoro-2-phenylpropanoic acid |
| InChIKey | HQRSIMQXCAWAJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)