CAS 56594-98-0 appears in our catalog under these names: 1-Cyclopropyl-2-(3-methylphenyl)ethan-1-one, 95%, 1-Cyclopropyl-2-(3-methylphenyl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
1-cyclopropyl-2-(3-methylphenyl)ethanone (CAS 56594-98-0) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 1-cyclopropyl-2-(3-methylphenyl)ethanone. InChIKey: PYOVWNDCBMIHAF-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 1-cyclopropyl-2-(3-methylphenyl)ethanone |
| InChIKey | PYOVWNDCBMIHAF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC(=O)C2CC2 |
Computed by PubChem (NCBI)