CAS 567-63-5 appears in our catalog under these names: 3-Fluoro-2-nitroaniline 98%, 3-Fluoro-2-nitroaniline, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g.
3-fluoro-2-nitroaniline (CAS 567-63-5) is a chemical compound with the molecular formula C6H5FN2O2 and a molecular weight of 156.11 g/mol. IUPAC name: 3-fluoro-2-nitroaniline. InChIKey: NSFGNLQLWFZHKK-UHFFFAOYSA-N.
| Molecular formula | C6H5FN2O2 |
|---|---|
| Molecular weight | 156.11 g/mol |
| IUPAC name | 3-fluoro-2-nitroaniline |
| InChIKey | NSFGNLQLWFZHKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])N |
Computed by PubChem (NCBI)