Products 56713-46-3
CAS 56713-46-3 is the registry number for 4-Chloro-α-[(ethoxycarbonyl)amino]benzeneacetic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-chlorophenyl)-2-(ethoxycarbonylamino)acetic acid (CAS 56713-46-3) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-(ethoxycarbonylamino)acetic acid. InChIKey: CCGXSSXPZGVBIE-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-(ethoxycarbonylamino)acetic acid |
| InChIKey | CCGXSSXPZGVBIE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)