Products 568551-21-3
CAS 568551-21-3 is the registry number for 2-Chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)acetamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)acetamide (CAS 568551-21-3) is a chemical compound with the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. IUPAC name: 2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)acetamide. InChIKey: KWRIGKBFSMBPDF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2OS |
|---|---|
| Molecular weight | 254.74 g/mol |
| IUPAC name | 2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)acetamide |
| InChIKey | KWRIGKBFSMBPDF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)SC(=N2)NC(=O)CCl)C |
Computed by PubChem (NCBI)