CAS 56895-88-6 is the registry number for 6-Amino-D-Tryptophan. Offered by: TRC. Available pack sizes: 500mg.
(2R)-2-amino-3-(6-amino-1H-indol-3-yl)propanoic acid (CAS 56895-88-6) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: (2R)-2-amino-3-(6-amino-1H-indol-3-yl)propanoic acid. InChIKey: URBHVZVPIHGYBQ-SECBINFHSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (2R)-2-amino-3-(6-amino-1H-indol-3-yl)propanoic acid |
| InChIKey | URBHVZVPIHGYBQ-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1N)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)