CAS 56935-77-4 is the registry number for 2-(2,2,2-Trifluoroethoxy)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,2,2-trifluoroethoxy)benzonitrile (CAS 56935-77-4) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: OESUQEWLLMDSDL-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | OESUQEWLLMDSDL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OCC(F)(F)F |
Computed by PubChem (NCBI)