CAS 56994-11-7 is the registry number for α-D-Mannopyranose,1,2,3,6-tetrabenzoate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3R,4S,5S,6R)-4,5,6-tribenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate (CAS 56994-11-7) is a chemical compound with the molecular formula C34H28O10 and a molecular weight of 596.6 g/mol. IUPAC name: [(2R,3R,4S,5S,6R)-4,5,6-tribenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate. InChIKey: IBHLAWIOLBRAAK-LSPAEZJRSA-N.
| Molecular formula | C34H28O10 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | [(2R,3R,4S,5S,6R)-4,5,6-tribenzoyloxy-3-hydroxyoxan-2-yl]methyl benzoate |
| InChIKey | IBHLAWIOLBRAAK-LSPAEZJRSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)O |
Computed by PubChem (NCBI)