Products 627466-64-2
CAS 627466-64-2 appears in our catalog under these names: 2,3,4,6-Tetrabenzoate D-glucopyranose, 2,3,4,6-Tetra-O-benzoyl-D-glucopyranose, >95.0%(HPLC), 2,3,4,6-Tetrabenzoate D-Glucopyranose, 95.0%, 95.0%. Offered by: Biosynth, TCI, Chemat. Available pack sizes: 1000mg, 250mg, 1g.
(3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl)methyl benzoate (CAS 627466-64-2) is a chemical compound with the molecular formula C34H28O10 and a molecular weight of 596.6 g/mol. IUPAC name: (3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl)methyl benzoate. InChIKey: FCDYAJBVISGNLC-UHFFFAOYSA-N.
| Molecular formula | C34H28O10 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | (3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl)methyl benzoate |
| InChIKey | FCDYAJBVISGNLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)