CAS 627466-98-2 appears in our catalog under these names: 2,3,4,6-Tetra-O-benzoyl-D-mannopyranose, (2R,3R,4S,5S)-2-((benzoyloxy)methyl)-6-hydroxytetrahydro-2H-pyran-3,4,5-triyl tribenzoate, 95%, 95%, D-Mannopyranose,2,3,4,6-tetrabenzoate. Offered by: TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1g, 2g, 5g, 0,5g, 10g, 100mg, 250mg, 1 g.
[(2R,3R,4S,5S)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate (CAS 627466-98-2) is a chemical compound with the molecular formula C34H28O10 and a molecular weight of 596.6 g/mol. IUPAC name: [(2R,3R,4S,5S)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate. InChIKey: FCDYAJBVISGNLC-FUDYUEBSSA-N.
| Molecular formula | C34H28O10 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | [(2R,3R,4S,5S)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
| InChIKey | FCDYAJBVISGNLC-FUDYUEBSSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@@H](C(O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)