Products 590367-95-6
CAS 590367-95-6 is the registry number for 1,2,3,4-Tetra-O-benzoyl-D-glucopyranose, >95% (HPLC). Offered by: TRC. Available pack sizes: 1g, 250mg, 50mg.
[(2R,3R,4S,5R)-4,5,6-tribenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate (CAS 590367-95-6) is a chemical compound with the molecular formula C34H28O10 and a molecular weight of 596.6 g/mol. IUPAC name: [(2R,3R,4S,5R)-4,5,6-tribenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate. InChIKey: JSXMRQAFUOMKAD-RIKJQNKOSA-N.
| Molecular formula | C34H28O10 |
|---|---|
| Molecular weight | 596.6 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-4,5,6-tribenzoyloxy-2-(hydroxymethyl)oxan-3-yl] benzoate |
| InChIKey | JSXMRQAFUOMKAD-RIKJQNKOSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)O[C@@H]2[C@H](OC([C@@H]([C@H]2OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)CO |
Computed by PubChem (NCBI)