Products 570-08-1
CAS 570-08-1 appears in our catalog under these names: Diethyl 2-Acetylmalonate, Diethyl acetylmalonate, Diethyl 2-acetylmalonate 95%, Diethyl 2-acetylmalonate, 90%, 90%, Diethyl 2-acetylmalonate, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100g, 25g, 500g.
Diethyl 2-acetylpropanedioate (CAS 570-08-1) is a chemical compound with the molecular formula C9H14O5 and a molecular weight of 202.20 g/mol. IUPAC name: diethyl 2-acetylpropanedioate. InChIKey: SQAUUQRBOCJRCW-UHFFFAOYSA-N.
| Molecular formula | C9H14O5 |
|---|---|
| Molecular weight | 202.20 g/mol |
| IUPAC name | diethyl 2-acetylpropanedioate |
| InChIKey | SQAUUQRBOCJRCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)C(=O)OCC |
Computed by PubChem (NCBI)