CAS 57013-94-2 appears in our catalog under these names: 4-Chloro-(1,1'-biphenyl)-3-amine, 97%, 4-Chloro-(1,1'-biphenyl)-3-amine, 4-Chloro[1,1'-biphenyl]-3-amine, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
2-chloro-5-phenylaniline (CAS 57013-94-2) is a chemical compound with the molecular formula C12H10ClN and a molecular weight of 203.67 g/mol. IUPAC name: 2-chloro-5-phenylaniline. InChIKey: AFQFQUUHEWDIGD-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN |
|---|---|
| Molecular weight | 203.67 g/mol |
| IUPAC name | 2-chloro-5-phenylaniline |
| InChIKey | AFQFQUUHEWDIGD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)