CAS 57032-14-1 appears in our catalog under these names: Quinoline-2,3-diyldimethanol, 97%, 2,3-Quinolinedimethanol, (3-(Hydroxymethyl)quinolin-2-yl)methanol. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
[2-(hydroxymethyl)quinolin-3-yl]methanol (CAS 57032-14-1) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: [2-(hydroxymethyl)quinolin-3-yl]methanol. InChIKey: UMELLZWPUHQWTB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | [2-(hydroxymethyl)quinolin-3-yl]methanol |
| InChIKey | UMELLZWPUHQWTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)CO)CO |
Computed by PubChem (NCBI)