CAS 57078-98-5 appears in our catalog under these names: 4-Maleimidobutyric acid 98%, 4-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)butanoic acid, 98%, 98%, 4–Maleimidobutyric acid, 4-Maleimidobutyric Acid, >98.0%(GC), 4-Maleimidobutyric acid. Offered by: Ambeed, Chemat, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500mg, 50g, 250g.
4-(2,5-dioxopyrrol-1-yl)butanoic acid (CAS 57078-98-5) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. IUPAC name: 4-(2,5-dioxopyrrol-1-yl)butanoic acid. InChIKey: NCPQROHLJFARLL-UHFFFAOYSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 183.16 g/mol |
| IUPAC name | 4-(2,5-dioxopyrrol-1-yl)butanoic acid |
| InChIKey | NCPQROHLJFARLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCC(=O)O |
Computed by PubChem (NCBI)