CAS 571158-97-9 appears in our catalog under these names: 2-amino-N-1,3-benzodioxol-5-ylbenzamide, 98%, 98%, 2-amino-N-1,3-benzodioxol-5-ylbenzamide. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g.
2-amino-N-(1,3-benzodioxol-5-yl)benzamide (CAS 571158-97-9) is a chemical compound with the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. IUPAC name: 2-amino-N-(1,3-benzodioxol-5-yl)benzamide. InChIKey: JSRJQMPXDZBFNI-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O3 |
|---|---|
| Molecular weight | 256.26 g/mol |
| IUPAC name | 2-amino-N-(1,3-benzodioxol-5-yl)benzamide |
| InChIKey | JSRJQMPXDZBFNI-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)C3=CC=CC=C3N |
Computed by PubChem (NCBI)