CAS 5717-91-9 is the registry number for 2-(Chloromethyl)-5-methyl-1,3-benzothiazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(chloromethyl)-5-methyl-1,3-benzothiazole (CAS 5717-91-9) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: 2-(chloromethyl)-5-methyl-1,3-benzothiazole. InChIKey: JTAKLGFADWCFCL-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methyl-1,3-benzothiazole |
| InChIKey | JTAKLGFADWCFCL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)SC(=N2)CCl |
Computed by PubChem (NCBI)