CAS 57170-09-9 is the registry number for 4’,6-Didemethyl Papaverine. Offered by: TRC. Available pack sizes: 1mg.
1-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methoxyisoquinolin-6-ol (CAS 57170-09-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: 1-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methoxyisoquinolin-6-ol. InChIKey: SSLURVVRTRZFQY-UHFFFAOYSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | 1-[(4-hydroxy-3-methoxyphenyl)methyl]-7-methoxyisoquinolin-6-ol |
| InChIKey | SSLURVVRTRZFQY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC2=NC=CC3=CC(=C(C=C32)OC)O)O |
Computed by PubChem (NCBI)